C15H18FNO3 — CID 66106213
7-fluoro-N-(4-hydroxy-2-methylbutyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 66106213) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 7-fluoro-N-(4-hydroxy-2-methylbutyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-(4-hydroxy-2-methylbutyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 66106213 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 7-fluoro-N-(4-hydroxy-2-methylbutyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCC(C)CCO)oc2c(F)cccc12 |
| InChI | InChI=1S/C15H18FNO3/c1-9(6-7-18)8-17-15(19)13-10(2)11-4-3-5-12(16)14(11)20-13/h3-5,9,18H,6-8H2,1-2H3,(H,17,19) |
| InChIKey | CROCVGDEKMRDFF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |