About 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide
7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 104927239) has the molecular formula C16H18FNO3
and a molecular weight of 291.32 g/mol. Its IUPAC name is 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide |
| PubChem CID | 104927239 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@@H]2CCCC[C@H]2O)oc2c(F)cccc12 |
| InChI | InChI=1S/C16H18FNO3/c1-9-10-5-4-6-11(17)15(10)21-14(9)16(20)18-12-7-2-3-8-13(12)19/h4-6,12-13,19H,2-3,7-8H2,1H3,(H,18,20)/t12-,13-/m1/s1 |
| InChIKey | HTEVZTZXOXVUGF-CHWSQXEVSA-N |
| XLogP | 2.91 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide?
The IUPAC name of 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide (CID 104927239) is 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide.
What is the SMILES notation for 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide?
The canonical SMILES for 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide is Cc1c(C(=O)N[C@@H]2CCCC[C@H]2O)oc2c(F)cccc12.
What is the InChIKey of 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide?
The InChIKey is HTEVZTZXOXVUGF-CHWSQXEVSA-N. The full InChI is InChI=1S/C16H18FNO3/c1-9-10-5-4-6-11(17)15(10)21-14(9)16(20)18-12-7-2-3-8-13(12)19/h4-6,12-13,19H,2-3,7-8H2,1H3,(H,18,20)/t12-,13-/m1/s1.
What are the key properties of 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide?
7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide has a molecular weight of 291.32 g/mol, XLogP of 2.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]-3-methyl-1-benzofuran-2-carboxamide is sourced from PubChem (CID 104927239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).