C15H16FNO3 — CID 115877896
7-fluoro-N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 115877896) has the molecular formula C15H16FNO3 and a molecular weight of 277.29 g/mol. Its IUPAC name is 7-fluoro-N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 115877896 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 7-fluoro-N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2(CO)CCC2)oc2c(F)cccc12 |
| InChI | InChI=1S/C15H16FNO3/c1-9-10-4-2-5-11(16)13(10)20-12(9)14(19)17-15(8-18)6-3-7-15/h2,4-5,18H,3,6-8H2,1H3,(H,17,19) |
| InChIKey | MTJLFJXHQGCTHA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |