C15H17NO3 — CID 115878297
N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 115878297) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 115878297 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclobutyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2(CO)CCC2)oc2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c1-10-11-5-2-3-6-12(11)19-13(10)14(18)16-15(9-17)7-4-8-15/h2-3,5-6,17H,4,7-9H2,1H3,(H,16,18) |
| InChIKey | QCMHAXDCSPHPNA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |