C20H19NO2 — CID 16602422
3-methyl-N-[(1-phenylcyclopropyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 16602422) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-methyl-N-[(1-phenylcyclopropyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-[(1-phenylcyclopropyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16602422 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-methyl-N-[(1-phenylcyclopropyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCC2(c3ccccc3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C20H19NO2/c1-14-16-9-5-6-10-17(16)23-18(14)19(22)21-13-20(11-12-20)15-7-3-2-4-8-15/h2-10H,11-13H2,1H3,(H,21,22) |
| InChIKey | CSHGNYWUYOJIGT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |