C13H12FNO4 — CID 43241826
2-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)-methylamino]acetic acid (PubChem CID 43241826) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)-methylamino]acetic acid.
| Compound Name | 2-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 43241826 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)-methylamino]acetic acid |
| SMILES | Cc1c(C(=O)N(C)CC(=O)O)oc2c(F)cccc12 |
| InChI | InChI=1S/C13H12FNO4/c1-7-8-4-3-5-9(14)12(8)19-11(7)13(18)15(2)6-10(16)17/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | GGJWSNRCYARGKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |