C14H13N5O4 — CID 41088748
[(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 5-methylfuran-2-carboxylate (PubChem CID 41088748) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 5-methylfuran-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 41088748 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 5-methylfuran-2-carboxylate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ncnc3nc[nH]c23)o1 |
| InChI | InChI=1S/C14H13N5O4/c1-7-3-4-9(22-7)14(21)23-8(2)13(20)19-12-10-11(16-5-15-10)17-6-18-12/h3-6,8H,1-2H3,(H2,15,16,17,18,19,20)/t8-/m0/s1 |
| InChIKey | DNWMNPQQHRWAGK-QMMMGPOBSA-N |
| XLogP | 1.44 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |