C25H23N7O4 — CID 24674452
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 24674452) has the molecular formula C25H23N7O4 and a molecular weight of 485.50 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24674452 |
| Molecular Formula | C25H23N7O4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)OC(C)C(=O)Nc3ncnc4nc[nH]c34)c2C)cc1 |
| InChI | InChI=1S/C25H23N7O4/c1-14-9-17(15(2)32(14)19-5-7-20(35-4)8-6-19)10-18(11-26)25(34)36-16(3)24(33)31-23-21-22(28-12-27-21)29-13-30-23/h5-10,12-13,16H,1-4H3,(H2,27,28,29,30,31,33)/b18-10+ |
| InChIKey | HHIZVEJOGGIOMK-VCHYOVAHSA-N |
| XLogP | 3.25 |
| TPSA | 147.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|