C28H32N4O4 — CID 16510256
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 16510256) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16510256 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)OC(C)C(=O)NC3(C#N)CCCCC3)c2C)cc1 |
| InChI | InChI=1S/C28H32N4O4/c1-5-35-25-11-9-24(10-12-25)32-19(2)15-22(20(32)3)16-23(17-29)27(34)36-21(4)26(33)31-28(18-30)13-7-6-8-14-28/h9-12,15-16,21H,5-8,13-14H2,1-4H3,(H,31,33)/b23-16+ |
| InChIKey | NZKJLEKQUOJZGW-XQNSMLJCSA-N |
| XLogP | 4.67 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|