C13H12N8O3 — CID 22108606
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-aminopyrazine-2-carboxylate (PubChem CID 22108606) has the molecular formula C13H12N8O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 22108606 |
| Molecular Formula | C13H12N8O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-aminopyrazine-2-carboxylate |
| SMILES | CC(OC(=O)c1nccnc1N)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H12N8O3/c1-6(24-13(23)7-9(14)16-3-2-15-7)12(22)21-11-8-10(18-4-17-8)19-5-20-11/h2-6H,1H3,(H2,14,16)(H2,17,18,19,20,21,22) |
| InChIKey | ZDHSKWAVDXHSJL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |