C16H14N6O5 — CID 30091144
[(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-methyl-6-nitrobenzoate (PubChem CID 30091144) has the molecular formula C16H14N6O5 and a molecular weight of 370.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-methyl-6-nitrobenzoate.
| Compound Name | [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 30091144 |
| Molecular Formula | C16H14N6O5 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [(2S)-1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 2-methyl-6-nitrobenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)O[C@@H](C)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H14N6O5/c1-8-4-3-5-10(22(25)26)11(8)16(24)27-9(2)15(23)21-14-12-13(18-6-17-12)19-7-20-14/h3-7,9H,1-2H3,(H2,17,18,19,20,21,23)/t9-/m0/s1 |
| InChIKey | FKIOIZWLFWRNKZ-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|