C13H12N6O — CID 585012
1-(2-methylphenyl)-3-(7H-purin-6-yl)urea (PubChem CID 585012) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-(7H-purin-6-yl)urea.
| Compound Name | 1-(2-methylphenyl)-3-(7H-purin-6-yl)urea |
|---|---|
| PubChem CID | 585012 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(2-methylphenyl)-3-(7H-purin-6-yl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H12N6O/c1-8-4-2-3-5-9(8)18-13(20)19-12-10-11(15-6-14-10)16-7-17-12/h2-7H,1H3,(H3,14,15,16,17,18,19,20) |
| InChIKey | SBHHSBKWSDKNJU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |