C12H12N4O — CID 6477188
1-(2-methylphenyl)-3-pyrimidin-2-ylurea (PubChem CID 6477188) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-pyrimidin-2-ylurea.
| Compound Name | 1-(2-methylphenyl)-3-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 6477188 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-(2-methylphenyl)-3-pyrimidin-2-ylurea |
| SMILES | Cc1ccccc1NC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C12H12N4O/c1-9-5-2-3-6-10(9)15-12(17)16-11-13-7-4-8-14-11/h2-8H,1H3,(H2,13,14,15,16,17) |
| InChIKey | SRHICACBHNQCCA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |