C14H14N4O2 — CID 44996588
N-(2,3-dimethylphenyl)-N'-pyrimidin-2-yloxamide (PubChem CID 44996588) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-pyrimidin-2-yloxamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-pyrimidin-2-yloxamide |
|---|---|
| PubChem CID | 44996588 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-pyrimidin-2-yloxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)Nc2ncccn2)c1C |
| InChI | InChI=1S/C14H14N4O2/c1-9-5-3-6-11(10(9)2)17-12(19)13(20)18-14-15-7-4-8-16-14/h3-8H,1-2H3,(H,17,19)(H,15,16,18,20) |
| InChIKey | IPUIUWDJKZQWFF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|