C9H10N6O3 — CID 131853482
(2S)-2-(7H-purin-6-ylcarbamoylamino)propanoic acid (PubChem CID 131853482) has the molecular formula C9H10N6O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is (2S)-2-(7H-purin-6-ylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-(7H-purin-6-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 131853482 |
| Molecular Formula | C9H10N6O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2S)-2-(7H-purin-6-ylcarbamoylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)Nc1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C9H10N6O3/c1-4(8(16)17)14-9(18)15-7-5-6(11-2-10-5)12-3-13-7/h2-4H,1H3,(H,16,17)(H3,10,11,12,13,14,15,18)/t4-/m0/s1 |
| InChIKey | LTWJINQZIQQYON-BYPYZUCNSA-N |
| XLogP | -0.05 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |