C12H8Cl2N6O — CID 11034643
1-(3,4-dichlorophenyl)-3-(7H-purin-6-yl)urea (PubChem CID 11034643) has the molecular formula C12H8Cl2N6O and a molecular weight of 323.14 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(7H-purin-6-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(7H-purin-6-yl)urea |
|---|---|
| PubChem CID | 11034643 |
| Molecular Formula | C12H8Cl2N6O |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(7H-purin-6-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H8Cl2N6O/c13-7-2-1-6(3-8(7)14)19-12(21)20-11-9-10(16-4-15-9)17-5-18-11/h1-5H,(H3,15,16,17,18,19,20,21) |
| InChIKey | ICOKDBQZUXPLMP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |