C8H10N4O3 — CID 41379743
[(2S)-1-amino-1-oxopropan-2-yl] 3-aminopyrazine-2-carboxylate (PubChem CID 41379743) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 41379743 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-aminopyrazine-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1nccnc1N)C(N)=O |
| InChI | InChI=1S/C8H10N4O3/c1-4(7(10)13)15-8(14)5-6(9)12-3-2-11-5/h2-4H,1H3,(H2,9,12)(H2,10,13)/t4-/m0/s1 |
| InChIKey | XJAVNQZGSRWJBY-BYPYZUCNSA-N |
| XLogP | -0.91 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |