C15H16N4O3 — CID 41074424
[(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 41074424) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 41074424 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | CN(C)C(=O)[C@@H](OC(=O)c1nccnc1N)c1ccccc1 |
| InChI | InChI=1S/C15H16N4O3/c1-19(2)14(20)12(10-6-4-3-5-7-10)22-15(21)11-13(16)18-9-8-17-11/h3-9,12H,1-2H3,(H2,16,18)/t12-/m0/s1 |
| InChIKey | ORHMUXOZOCDRFR-LBPRGKRZSA-N |
| XLogP | 1.05 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |