C16H17NO3S — CID 9415083
[(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 5-methylthiophene-2-carboxylate (PubChem CID 9415083) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 5-methylthiophene-2-carboxylate.
| Compound Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 9415083 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C(=O)N(C)C)c2ccccc2)s1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-9-10-13(21-11)16(19)20-14(15(18)17(2)3)12-7-5-4-6-8-12/h4-10,14H,1-3H3/t14-/m1/s1 |
| InChIKey | RLMVUDPCCMLIBM-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |