About [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate
[2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate (PubChem CID 18199169) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate |
| PubChem CID | 18199169 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OC(C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3S/c1-19(2)17(20)16(13-9-5-4-6-10-13)22-18(21)14-11-7-8-12-15(14)23-3/h4-12,16H,1-3H3 |
| InChIKey | LAURKFJPHXAEJS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate?
The IUPAC name of [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate (CID 18199169) is [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate.
What is the SMILES notation for [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate?
The canonical SMILES for [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate is CSc1ccccc1C(=O)OC(C(=O)N(C)C)c1ccccc1.
What is the InChIKey of [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate?
The InChIKey is LAURKFJPHXAEJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c1-19(2)17(20)16(13-9-5-4-6-10-13)22-18(21)14-11-7-8-12-15(14)23-3/h4-12,16H,1-3H3.
What are the key properties of [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate?
[2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate has a molecular weight of 329.42 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-2-oxo-1-phenylethyl] 2-methylsulfanylbenzoate is sourced from PubChem (CID 18199169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).