C18H18N2O4 — CID 27765842
[(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-carbamoylbenzoate (PubChem CID 27765842) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-carbamoylbenzoate.
| Compound Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-carbamoylbenzoate |
|---|---|
| PubChem CID | 27765842 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-carbamoylbenzoate |
| SMILES | CN(C)C(=O)[C@@H](OC(=O)c1ccc(C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4/c1-20(2)17(22)15(12-6-4-3-5-7-12)24-18(23)14-10-8-13(9-11-14)16(19)21/h3-11,15H,1-2H3,(H2,19,21)/t15-/m0/s1 |
| InChIKey | GNYKYVCNGBZLAJ-HNNXBMFYSA-N |
| XLogP | 1.77 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |