C20H24N2O5S — CID 27614893
[(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-[2-(methanesulfonamido)ethyl]benzoate (PubChem CID 27614893) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-[2-(methanesulfonamido)ethyl]benzoate.
| Compound Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-[2-(methanesulfonamido)ethyl]benzoate |
|---|---|
| PubChem CID | 27614893 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 4-[2-(methanesulfonamido)ethyl]benzoate |
| SMILES | CN(C)C(=O)[C@H](OC(=O)c1ccc(CCNS(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-22(2)19(23)18(16-7-5-4-6-8-16)27-20(24)17-11-9-15(10-12-17)13-14-21-28(3,25)26/h4-12,18,21H,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | QZRKBYRYHNATDH-GOSISDBHSA-N |
| XLogP | 1.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |