C23H25NO3 — CID 3129256
N-[(2-hydroxynaphthalen-1-yl)-(2-methoxyphenyl)methyl]pentanamide (PubChem CID 3129256) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-(2-methoxyphenyl)methyl]pentanamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-(2-methoxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 3129256 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-(2-methoxyphenyl)methyl]pentanamide |
| SMILES | CCCCC(=O)NC(c1ccccc1OC)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H25NO3/c1-3-4-13-21(26)24-23(18-11-7-8-12-20(18)27-2)22-17-10-6-5-9-16(17)14-15-19(22)25/h5-12,14-15,23,25H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | OMBTVYOJNGWQKJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|