C25H21NO3 — CID 2787112
N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-2-methoxybenzamide (PubChem CID 2787112) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-2-methoxybenzamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 2787112 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H21NO3/c1-29-22-14-8-7-13-20(22)25(28)26-24(18-10-3-2-4-11-18)23-19-12-6-5-9-17(19)15-16-21(23)27/h2-16,24,27H,1H3,(H,26,28) |
| InChIKey | QEGFNJKRANLPDR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|