C26H24N2O3 — CID 42954212
1-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 42954212) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42954212 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC(c2ccccc2)c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-31-21-14-11-18(12-15-21)17-27-26(30)28-25(20-8-3-2-4-9-20)24-22-10-6-5-7-19(22)13-16-23(24)29/h2-16,25,29H,17H2,1H3,(H2,27,28,30) |
| InChIKey | CACYHUIOXCICKM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|