C19H14F3NO2 — CID 721381
2,2,2-trifluoro-N-[(S)-(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide (PubChem CID 721381) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(S)-(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(S)-(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 721381 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(S)-(2-hydroxynaphthalen-1-yl)-phenylmethyl]acetamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1c(O)ccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO2/c20-19(21,22)18(25)23-17(13-7-2-1-3-8-13)16-14-9-5-4-6-12(14)10-11-15(16)24/h1-11,17,24H,(H,23,25)/t17-/m0/s1 |
| InChIKey | FXDVXIHUTSMGQI-KRWDZBQOSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|