C23H17ClN2O2 — CID 134025883
2-chloro-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]pyridine-4-carboxamide (PubChem CID 134025883) has the molecular formula C23H17ClN2O2 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-chloro-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134025883 |
| Molecular Formula | C23H17ClN2O2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-chloro-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]pyridine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1c(O)ccc2ccccc12)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C23H17ClN2O2/c24-20-14-17(12-13-25-20)23(28)26-22(16-7-2-1-3-8-16)21-18-9-5-4-6-15(18)10-11-19(21)27/h1-14,22,27H,(H,26,28) |
| InChIKey | FEGPYGPZJGPHKA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|