C24H18BrNO3 — CID 122396722
N-[(5-bromo-2-hydroxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide (PubChem CID 122396722) has the molecular formula C24H18BrNO3 and a molecular weight of 448.32 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122396722 |
| Molecular Formula | C24H18BrNO3 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide |
| SMILES | O=C(NC(c1cc(Br)ccc1O)c1c(O)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H18BrNO3/c25-17-11-13-20(27)19(14-17)23(26-24(29)16-7-2-1-3-8-16)22-18-9-5-4-6-15(18)10-12-21(22)28/h1-14,23,27-28H,(H,26,29) |
| InChIKey | VEWRDTOFGJAMAZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|