C19H16BrNO3 — CID 102512897
methyl N-[(3-bromophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate (PubChem CID 102512897) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is methyl N-[(3-bromophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate.
| Compound Name | methyl N-[(3-bromophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 102512897 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | methyl N-[(3-bromophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate |
| SMILES | COC(=O)NC(c1cccc(Br)c1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C19H16BrNO3/c1-24-19(23)21-18(13-6-4-7-14(20)11-13)17-15-8-3-2-5-12(15)9-10-16(17)22/h2-11,18,22H,1H3,(H,21,23) |
| InChIKey | YFHGJUDMZSPYDG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|