C21H19NO3 — CID 102482362
N-[(2-hydroxynaphthalen-1-yl)-(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 102482362) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 102482362 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccc(OC)cc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C21H19NO3/c1-3-19(24)22-21(15-8-11-16(25-2)12-9-15)20-17-7-5-4-6-14(17)10-13-18(20)23/h3-13,21,23H,1H2,2H3,(H,22,24) |
| InChIKey | AYBWCHSMQXYCKA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|