C19H21NO4 — CID 139017490
N-[(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 139017490) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 139017490 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccc(OC)cc1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H21NO4/c1-5-18(21)20-19(13-6-8-14(22-2)9-7-13)16-11-10-15(23-3)12-17(16)24-4/h5-12,19H,1H2,2-4H3,(H,20,21) |
| InChIKey | IHRRYKCQDUXYMB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|