C13H18ClNO3 — CID 55048004
2-chloro-2-(2,4-dimethoxyphenyl)-N-propan-2-ylacetamide (PubChem CID 55048004) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 2-chloro-2-(2,4-dimethoxyphenyl)-N-propan-2-ylacetamide.
| Compound Name | 2-chloro-2-(2,4-dimethoxyphenyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55048004 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-chloro-2-(2,4-dimethoxyphenyl)-N-propan-2-ylacetamide |
| SMILES | COc1ccc(C(Cl)C(=O)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H18ClNO3/c1-8(2)15-13(16)12(14)10-6-5-9(17-3)7-11(10)18-4/h5-8,12H,1-4H3,(H,15,16) |
| InChIKey | ALHMFDFHUXRQSA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|