C10H14ClNO2 — CID 116962062
1-chloro-1-(2,4-dimethoxyphenyl)-N-methylmethanamine (PubChem CID 116962062) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 1-chloro-1-(2,4-dimethoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-chloro-1-(2,4-dimethoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116962062 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-chloro-1-(2,4-dimethoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(Cl)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C10H14ClNO2/c1-12-10(11)8-5-4-7(13-2)6-9(8)14-3/h4-6,10,12H,1-3H3 |
| InChIKey | PCJMZEFRWRKAKA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|