C12H20N2O3 — CID 116957643
3-amino-1-(2,4-dimethoxyphenyl)-1-(methylamino)propan-2-ol (PubChem CID 116957643) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-amino-1-(2,4-dimethoxyphenyl)-1-(methylamino)propan-2-ol.
| Compound Name | 3-amino-1-(2,4-dimethoxyphenyl)-1-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 116957643 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-amino-1-(2,4-dimethoxyphenyl)-1-(methylamino)propan-2-ol |
| SMILES | CNC(c1ccc(OC)cc1OC)C(O)CN |
| InChI | InChI=1S/C12H20N2O3/c1-14-12(10(15)7-13)9-5-4-8(16-2)6-11(9)17-3/h4-6,10,12,14-15H,7,13H2,1-3H3 |
| InChIKey | FOWYPNJXEVOFBZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |