C10H11ClF2O2 — CID 103514415
1-(1-chloro-2,2-difluoroethyl)-2,4-dimethoxybenzene (PubChem CID 103514415) has the molecular formula C10H11ClF2O2 and a molecular weight of 236.65 g/mol. Its IUPAC name is 1-(1-chloro-2,2-difluoroethyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(1-chloro-2,2-difluoroethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 103514415 |
| Molecular Formula | C10H11ClF2O2 |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-(1-chloro-2,2-difluoroethyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(C(Cl)C(F)F)c(OC)c1 |
| InChI | InChI=1S/C10H11ClF2O2/c1-14-6-3-4-7(8(5-6)15-2)9(11)10(12)13/h3-5,9-10H,1-2H3 |
| InChIKey | LBIQMEZUDVSVTQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|