C10H14O2S — CID 43124104
1-(2,4-dimethoxyphenyl)ethanethiol (PubChem CID 43124104) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)ethanethiol.
| Compound Name | 1-(2,4-dimethoxyphenyl)ethanethiol |
|---|---|
| PubChem CID | 43124104 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)ethanethiol |
| SMILES | COc1ccc(C(C)S)c(OC)c1 |
| InChI | InChI=1S/C10H14O2S/c1-7(13)9-5-4-8(11-2)6-10(9)12-3/h4-7,13H,1-3H3 |
| InChIKey | ZNBACIJWYYTMIM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|