C21H28O2 — CID 134977558
2,4-dimethoxy-1-[(1S,2R)-2,3,3-trimethyl-1-phenylbutyl]benzene (PubChem CID 134977558) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2,4-dimethoxy-1-[(1S,2R)-2,3,3-trimethyl-1-phenylbutyl]benzene.
| Compound Name | 2,4-dimethoxy-1-[(1S,2R)-2,3,3-trimethyl-1-phenylbutyl]benzene |
|---|---|
| PubChem CID | 134977558 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 2,4-dimethoxy-1-[(1S,2R)-2,3,3-trimethyl-1-phenylbutyl]benzene |
| SMILES | COc1ccc([C@H](c2ccccc2)[C@@H](C)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H28O2/c1-15(21(2,3)4)20(16-10-8-7-9-11-16)18-13-12-17(22-5)14-19(18)23-6/h7-15,20H,1-6H3/t15-,20+/m1/s1 |
| InChIKey | ZZGGNUOOMDCOHT-QRWLVFNGSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |