C31H33NO3 — CID 19173596
4-(4-tert-butylphenoxy)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]butanamide (PubChem CID 19173596) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]butanamide |
|---|---|
| PubChem CID | 19173596 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NC(c2ccccc2)c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C31H33NO3/c1-31(2,3)24-16-18-25(19-17-24)35-21-9-14-28(34)32-30(23-11-5-4-6-12-23)29-26-13-8-7-10-22(26)15-20-27(29)33/h4-8,10-13,15-20,30,33H,9,14,21H2,1-3H3,(H,32,34) |
| InChIKey | IZYQQIUBYTYYEJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|