C21H20ClNO2 — CID 2876947
N-[(4-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]butanamide (PubChem CID 2876947) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]butanamide.
| Compound Name | N-[(4-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]butanamide |
|---|---|
| PubChem CID | 2876947 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(4-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]butanamide |
| SMILES | CCCC(=O)NC(c1ccc(Cl)cc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C21H20ClNO2/c1-2-5-19(25)23-21(15-8-11-16(22)12-9-15)20-17-7-4-3-6-14(17)10-13-18(20)24/h3-4,6-13,21,24H,2,5H2,1H3,(H,23,25) |
| InChIKey | OBSLLBGZNQWPID-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|