C19H16ClNO3 — CID 801283
N-[(R)-(4-chlorophenyl)-(2,7-dihydroxynaphthalen-1-yl)methyl]acetamide (PubChem CID 801283) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-(2,7-dihydroxynaphthalen-1-yl)methyl]acetamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-(2,7-dihydroxynaphthalen-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 801283 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-(2,7-dihydroxynaphthalen-1-yl)methyl]acetamide |
| SMILES | CC(=O)N[C@H](c1ccc(Cl)cc1)c1c(O)ccc2ccc(O)cc12 |
| InChI | InChI=1S/C19H16ClNO3/c1-11(22)21-19(13-2-6-14(20)7-3-13)18-16-10-15(23)8-4-12(16)5-9-17(18)24/h2-10,19,23-24H,1H3,(H,21,22)/t19-/m1/s1 |
| InChIKey | NJFAWVRYGNIMCP-LJQANCHMSA-N |
| XLogP | 4.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|