C20H17Cl2NO3 — CID 102495715
ethyl N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate (PubChem CID 102495715) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is ethyl N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate.
| Compound Name | ethyl N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 102495715 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | ethyl N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]carbamate |
| SMILES | CCOC(=O)NC(c1ccc(Cl)cc1Cl)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H17Cl2NO3/c1-2-26-20(25)23-19(15-9-8-13(21)11-16(15)22)18-14-6-4-3-5-12(14)7-10-17(18)24/h3-11,19,24H,2H2,1H3,(H,23,25) |
| InChIKey | SEBIHGMUTVUNKV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|