C25H20N2O5 — CID 2897625
N-[(2-hydroxynaphthalen-1-yl)-(4-nitrophenyl)methyl]-2-phenoxyacetamide (PubChem CID 2897625) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-(4-nitrophenyl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-(4-nitrophenyl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 2897625 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-(4-nitrophenyl)methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(c1ccc([N+](=O)[O-])cc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H20N2O5/c28-22-15-12-17-6-4-5-9-21(17)24(22)25(18-10-13-19(14-11-18)27(30)31)26-23(29)16-32-20-7-2-1-3-8-20/h1-15,25,28H,16H2,(H,26,29) |
| InChIKey | CFBFOZIOIWMQQJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|