C27H30N2O3 — CID 86880225
N-[3-[[(2-hydroxynaphthalen-1-yl)-phenylmethyl]amino]-3-oxopropyl]cyclohexanecarboxamide (PubChem CID 86880225) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[3-[[(2-hydroxynaphthalen-1-yl)-phenylmethyl]amino]-3-oxopropyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[(2-hydroxynaphthalen-1-yl)-phenylmethyl]amino]-3-oxopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 86880225 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[3-[[(2-hydroxynaphthalen-1-yl)-phenylmethyl]amino]-3-oxopropyl]cyclohexanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCCC1)NC(c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C27H30N2O3/c30-23-16-15-19-9-7-8-14-22(19)25(23)26(20-10-3-1-4-11-20)29-24(31)17-18-28-27(32)21-12-5-2-6-13-21/h1,3-4,7-11,14-16,21,26,30H,2,5-6,12-13,17-18H2,(H,28,32)(H,29,31) |
| InChIKey | GRYWJOAHCALSOD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|