C21H12N2O6S-2 — CID 102164713
3-oxido-4-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-carboxylate (PubChem CID 102164713) has the molecular formula C21H12N2O6S-2 and a molecular weight of 420.40 g/mol. Its IUPAC name is 3-oxido-4-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-carboxylate.
| Compound Name | 3-oxido-4-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 102164713 |
| Molecular Formula | C21H12N2O6S-2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 3-oxido-4-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-carboxylate |
| SMILES | O=C([O-])c1cc2ccccc2c(/N=N/c2ccc3ccccc3c2S(=O)(=O)O)c1[O-] |
| InChI | InChI=1S/C21H14N2O6S/c24-19-16(21(25)26)11-13-6-2-3-7-14(13)18(19)23-22-17-10-9-12-5-1-4-8-15(12)20(17)30(27,28)29/h1-11,24H,(H,25,26)(H,27,28,29)/p-2/b23-22+ |
| InChIKey | PWUSHZPXYOALFZ-GHVJWSGMSA-L |
| XLogP | 3.09 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|