C13H12N6 — CID 135510724
4-(naphthalen-1-yldiazenyl)-1H-pyrazole-3,5-diamine (PubChem CID 135510724) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is 4-(naphthalen-1-yldiazenyl)-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(naphthalen-1-yldiazenyl)-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135510724 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-(naphthalen-1-yldiazenyl)-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C13H12N6/c14-12-11(13(15)19-18-12)17-16-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H5,14,15,18,19)/b17-16+ |
| InChIKey | ULGBLRQVUYBYQK-WUKNDPDISA-N |
| XLogP | 3.14 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|