C10H12N6O — CID 1494746
4-[(3-methoxyphenyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 1494746) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 4-[(3-methoxyphenyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(3-methoxyphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 1494746 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-[(3-methoxyphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | COc1cccc(/N=N/c2c(N)n[nH]c2N)c1 |
| InChI | InChI=1S/C10H12N6O/c1-17-7-4-2-3-6(5-7)13-14-8-9(11)15-16-10(8)12/h2-5H,1H3,(H5,11,12,15,16)/b14-13+ |
| InChIKey | ZWASCGYRHBJNHS-BUHFOSPRSA-N |
| XLogP | 2.00 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|