C19H18N12O — CID 135461066
bis[4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone (PubChem CID 135461066) has the molecular formula C19H18N12O and a molecular weight of 430.44 g/mol. Its IUPAC name is bis[4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone.
| Compound Name | bis[4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone |
|---|---|
| PubChem CID | 135461066 |
| Molecular Formula | C19H18N12O |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | bis[4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc(C(=O)c2ccc(/N=N/c3c(N)n[nH]c3N)cc2)cc1 |
| InChI | InChI=1S/C19H18N12O/c20-16-13(17(21)29-28-16)26-24-11-5-1-9(2-6-11)15(32)10-3-7-12(8-4-10)25-27-14-18(22)30-31-19(14)23/h1-8H,(H5,20,21,28,29)(H5,22,23,30,31)/b26-24+,27-25+ |
| InChIKey | IYTXVWLGZLUFNA-OWUYFMIJSA-N |
| XLogP | 3.52 |
| TPSA | 227.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|