C9H9FN6 — CID 694534
4-[(3-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 694534) has the molecular formula C9H9FN6 and a molecular weight of 220.21 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(3-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 694534 |
| Molecular Formula | C9H9FN6 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4-[(3-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1cccc(F)c1 |
| InChI | InChI=1S/C9H9FN6/c10-5-2-1-3-6(4-5)13-14-7-8(11)15-16-9(7)12/h1-4H,(H5,11,12,15,16)/b14-13+ |
| InChIKey | IIMNZOCCIUNMSH-BUHFOSPRSA-N |
| XLogP | 2.13 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|