C15H13FN8O — CID 174486144
N-[[3-amino-4-[(3-fluorophenyl)diazenyl]-1H-pyrazol-5-yl]methyl]pyrazine-2-carboxamide (PubChem CID 174486144) has the molecular formula C15H13FN8O and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[[3-amino-4-[(3-fluorophenyl)diazenyl]-1H-pyrazol-5-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[3-amino-4-[(3-fluorophenyl)diazenyl]-1H-pyrazol-5-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174486144 |
| Molecular Formula | C15H13FN8O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[[3-amino-4-[(3-fluorophenyl)diazenyl]-1H-pyrazol-5-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Nc1n[nH]c(CNC(=O)c2cnccn2)c1/N=N/c1cccc(F)c1 |
| InChI | InChI=1S/C15H13FN8O/c16-9-2-1-3-10(6-9)21-23-13-11(22-24-14(13)17)8-20-15(25)12-7-18-4-5-19-12/h1-7H,8H2,(H,20,25)(H3,17,22,24)/b23-21+ |
| InChIKey | MKGRDAKECSQONC-XTQSDGFTSA-N |
| XLogP | 2.27 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|