C9H8ClFN6 — CID 135525489
4-[(5-chloro-2-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135525489) has the molecular formula C9H8ClFN6 and a molecular weight of 254.66 g/mol. Its IUPAC name is 4-[(5-chloro-2-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(5-chloro-2-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135525489 |
| Molecular Formula | C9H8ClFN6 |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-[(5-chloro-2-fluorophenyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1cc(Cl)ccc1F |
| InChI | InChI=1S/C9H8ClFN6/c10-4-1-2-5(11)6(3-4)14-15-7-8(12)16-17-9(7)13/h1-3H,(H5,12,13,16,17)/b15-14+ |
| InChIKey | SEIZYPMOSSAMTG-CCEZHUSRSA-N |
| XLogP | 2.78 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|